About 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline
4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline (PubChem CID 139220169) has the molecular formula C21H27N
and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline |
| PubChem CID | 139220169 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline |
| SMILES | CC(C)(C)CC1(C)CC(c2ccccc2)Nc2ccccc21 |
| InChI | InChI=1S/C21H27N/c1-20(2,3)15-21(4)14-19(16-10-6-5-7-11-16)22-18-13-9-8-12-17(18)21/h5-13,19,22H,14-15H2,1-4H3 |
| InChIKey | CGCXREJMXGZEGE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline?
The IUPAC name of 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline (CID 139220169) is 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline.
What is the SMILES notation for 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline?
The canonical SMILES for 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline is CC(C)(C)CC1(C)CC(c2ccccc2)Nc2ccccc21.
What is the InChIKey of 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline?
The InChIKey is CGCXREJMXGZEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N/c1-20(2,3)15-21(4)14-19(16-10-6-5-7-11-16)22-18-13-9-8-12-17(18)21/h5-13,19,22H,14-15H2,1-4H3.
What are the key properties of 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline?
4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline has a molecular weight of 293.45 g/mol, XLogP of 5.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropyl)-4-methyl-2-phenyl-2,3-dihydro-1H-quinoline is sourced from PubChem (CID 139220169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).