C26H15NO6 — CID 139220239
13-(4-hydroxy-3-nitrophenyl)-2,10-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaen-11-one (PubChem CID 139220239) has the molecular formula C26H15NO6 and a molecular weight of 437.41 g/mol. Its IUPAC name is 13-(4-hydroxy-3-nitrophenyl)-2,10-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaen-11-one.
| Compound Name | 13-(4-hydroxy-3-nitrophenyl)-2,10-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaen-11-one |
|---|---|
| PubChem CID | 139220239 |
| Molecular Formula | C26H15NO6 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 13-(4-hydroxy-3-nitrophenyl)-2,10-dioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaen-11-one |
| SMILES | O=c1oc2ccccc2c2c1C(c1ccc(O)c([N+](=O)[O-])c1)c1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C26H15NO6/c28-19-11-9-15(13-18(19)27(30)31)22-23-16-6-2-1-5-14(16)10-12-21(23)32-25-17-7-3-4-8-20(17)33-26(29)24(22)25/h1-13,22,28H |
| InChIKey | YCFWRVSWMCXYNK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|