About methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate
methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate (PubChem CID 139220460) has the molecular formula C11H12Cl2N2O2
and a molecular weight of 275.13 g/mol. Its IUPAC name is methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate.
Molecular Properties
| Compound Name | methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate |
| PubChem CID | 139220460 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate |
| SMILES | CCN/N=C(\C(=O)OC)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-3-14-15-10(11(16)17-2)7-5-4-6-8(12)9(7)13/h4-6,14H,3H2,1-2H3/b15-10- |
| InChIKey | DVEBKFQZDQAZNN-GDNBJRDFSA-N |
| XLogP | 2.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate?
The IUPAC name of methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate (CID 139220460) is methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate.
What is the SMILES notation for methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate?
The canonical SMILES for methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate is CCN/N=C(\C(=O)OC)c1cccc(Cl)c1Cl.
What is the InChIKey of methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate?
The InChIKey is DVEBKFQZDQAZNN-GDNBJRDFSA-N. The full InChI is InChI=1S/C11H12Cl2N2O2/c1-3-14-15-10(11(16)17-2)7-5-4-6-8(12)9(7)13/h4-6,14H,3H2,1-2H3/b15-10-.
What are the key properties of methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate?
methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate has a molecular weight of 275.13 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-(2,3-dichlorophenyl)-2-(ethylhydrazinylidene)acetate is sourced from PubChem (CID 139220460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).