C13H10Cl2N4OS — CID 139220559
5-[4-chloro-1-(4-chlorophenyl)-3-ethylpyrazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 139220559) has the molecular formula C13H10Cl2N4OS and a molecular weight of 341.22 g/mol. Its IUPAC name is 5-[4-chloro-1-(4-chlorophenyl)-3-ethylpyrazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[4-chloro-1-(4-chlorophenyl)-3-ethylpyrazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 139220559 |
| Molecular Formula | C13H10Cl2N4OS |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 5-[4-chloro-1-(4-chlorophenyl)-3-ethylpyrazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCc1nn(-c2ccc(Cl)cc2)c(-c2n[nH]c(=S)o2)c1Cl |
| InChI | InChI=1S/C13H10Cl2N4OS/c1-2-9-10(15)11(12-16-17-13(21)20-12)19(18-9)8-5-3-7(14)4-6-8/h3-6H,2H2,1H3,(H,17,21) |
| InChIKey | SKAULVNOPBDICP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|