About 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide
6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide (PubChem CID 139220856) has the molecular formula C12H13N5O
and a molecular weight of 243.27 g/mol. Its IUPAC name is 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide |
| PubChem CID | 139220856 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide |
| SMILES | NNC(=O)c1ccc(NNC=C2C=CC=C2)nc1 |
| InChI | InChI=1S/C12H13N5O/c13-16-12(18)10-5-6-11(14-8-10)17-15-7-9-3-1-2-4-9/h1-8,15H,13H2,(H,14,17)(H,16,18) |
| InChIKey | YPGBOGJJJGFMQV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide?
The IUPAC name of 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide (CID 139220856) is 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide.
What is the SMILES notation for 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide?
The canonical SMILES for 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide is NNC(=O)c1ccc(NNC=C2C=CC=C2)nc1.
What is the InChIKey of 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide?
The InChIKey is YPGBOGJJJGFMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O/c13-16-12(18)10-5-6-11(14-8-10)17-15-7-9-3-1-2-4-9/h1-8,15H,13H2,(H,14,17)(H,16,18).
What are the key properties of 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide?
6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide has a molecular weight of 243.27 g/mol, XLogP of 0.61, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(cyclopenta-2,4-dien-1-ylidenemethyl)hydrazinyl]pyridine-3-carbohydrazide is sourced from PubChem (CID 139220856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).