C16H10F3N5OS — CID 139220938
1-[6-methyl-11-thiophen-2-yl-13-(trifluoromethyl)-3,4,7,8,10-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl]ethanone (PubChem CID 139220938) has the molecular formula C16H10F3N5OS and a molecular weight of 377.35 g/mol. Its IUPAC name is 1-[6-methyl-11-thiophen-2-yl-13-(trifluoromethyl)-3,4,7,8,10-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl]ethanone.
| Compound Name | 1-[6-methyl-11-thiophen-2-yl-13-(trifluoromethyl)-3,4,7,8,10-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl]ethanone |
|---|---|
| PubChem CID | 139220938 |
| Molecular Formula | C16H10F3N5OS |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 1-[6-methyl-11-thiophen-2-yl-13-(trifluoromethyl)-3,4,7,8,10-pentazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl]ethanone |
| SMILES | CC(=O)c1nnc2c3c(C(F)(F)F)cc(-c4cccs4)nc3nn2c1C |
| InChI | InChI=1S/C16H10F3N5OS/c1-7-13(8(2)25)21-22-15-12-9(16(17,18)19)6-10(11-4-3-5-26-11)20-14(12)23-24(7)15/h3-6H,1-2H3 |
| InChIKey | HIOHEZOIUKUSQY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |