About (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione
(4S)-4-butan-2-yl-1,3-oxazolidine-2-thione (PubChem CID 139221157) has the molecular formula C7H13NOS
and a molecular weight of 159.25 g/mol. Its IUPAC name is (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione.
Molecular Properties
| Compound Name | (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione |
| PubChem CID | 139221157 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione |
| SMILES | CCC(C)[C@H]1COC(=S)N1 |
| InChI | InChI=1S/C7H13NOS/c1-3-5(2)6-4-9-7(10)8-6/h5-6H,3-4H2,1-2H3,(H,8,10)/t5?,6-/m1/s1 |
| InChIKey | UTRIXNRREBKZHK-PRJDIBJQSA-N |
| XLogP | 1.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione?
The IUPAC name of (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione (CID 139221157) is (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione.
What is the SMILES notation for (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione?
The canonical SMILES for (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione is CCC(C)[C@H]1COC(=S)N1.
What is the InChIKey of (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione?
The InChIKey is UTRIXNRREBKZHK-PRJDIBJQSA-N. The full InChI is InChI=1S/C7H13NOS/c1-3-5(2)6-4-9-7(10)8-6/h5-6H,3-4H2,1-2H3,(H,8,10)/t5?,6-/m1/s1.
What are the key properties of (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione?
(4S)-4-butan-2-yl-1,3-oxazolidine-2-thione has a molecular weight of 159.25 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-butan-2-yl-1,3-oxazolidine-2-thione is sourced from PubChem (CID 139221157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).