C29H23N5O3 — CID 139221302
6-amino-5-[(5-hydroxybenzo[a]phenazin-6-yl)-phenylmethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 139221302) has the molecular formula C29H23N5O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is 6-amino-5-[(5-hydroxybenzo[a]phenazin-6-yl)-phenylmethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(5-hydroxybenzo[a]phenazin-6-yl)-phenylmethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139221302 |
| Molecular Formula | C29H23N5O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 6-amino-5-[(5-hydroxybenzo[a]phenazin-6-yl)-phenylmethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(C(c2ccccc2)c2c(O)c3ccccc3c3nc4ccccc4nc23)c(=O)n(C)c1=O |
| InChI | InChI=1S/C29H23N5O3/c1-33-27(30)23(28(36)34(2)29(33)37)21(16-10-4-3-5-11-16)22-25-24(17-12-6-7-13-18(17)26(22)35)31-19-14-8-9-15-20(19)32-25/h3-15,21,35H,30H2,1-2H3 |
| InChIKey | OEZGCFLNYUZOTA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|