C19H14ClFN2 — CID 139221329
6-chloro-4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene (PubChem CID 139221329) has the molecular formula C19H14ClFN2 and a molecular weight of 324.79 g/mol. Its IUPAC name is 6-chloro-4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene.
| Compound Name | 6-chloro-4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene |
|---|---|
| PubChem CID | 139221329 |
| Molecular Formula | C19H14ClFN2 |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 6-chloro-4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene |
| SMILES | Fc1ccc(-c2nc(Cl)c3c(n2)-c2ccccc2CCC3)cc1 |
| InChI | InChI=1S/C19H14ClFN2/c20-18-16-7-3-5-12-4-1-2-6-15(12)17(16)22-19(23-18)13-8-10-14(21)11-9-13/h1-2,4,6,8-11H,3,5,7H2 |
| InChIKey | NHGICHYWJRXBSH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |