C21H20FN3O — CID 139221339
2-[[4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl]amino]ethanol (PubChem CID 139221339) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl]amino]ethanol.
| Compound Name | 2-[[4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 139221339 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl]amino]ethanol |
| SMILES | OCCNc1nc(-c2ccc(F)cc2)nc2c1CCCc1ccccc1-2 |
| InChI | InChI=1S/C21H20FN3O/c22-16-10-8-15(9-11-16)20-24-19-17-6-2-1-4-14(17)5-3-7-18(19)21(25-20)23-12-13-26/h1-2,4,6,8-11,26H,3,5,7,12-13H2,(H,23,24,25) |
| InChIKey | HVYWVTGZFUIUIQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |