C25H23N5O5 — CID 139221437
2-[4-[4-[[5-methoxy-2-(1,2-oxazol-5-yl)phenoxy]methyl]triazol-1-yl]butyl]isoindole-1,3-dione (PubChem CID 139221437) has the molecular formula C25H23N5O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is 2-[4-[4-[[5-methoxy-2-(1,2-oxazol-5-yl)phenoxy]methyl]triazol-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[[5-methoxy-2-(1,2-oxazol-5-yl)phenoxy]methyl]triazol-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139221437 |
| Molecular Formula | C25H23N5O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[4-[4-[[5-methoxy-2-(1,2-oxazol-5-yl)phenoxy]methyl]triazol-1-yl]butyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2ccno2)c(OCc2cn(CCCCN3C(=O)c4ccccc4C3=O)nn2)c1 |
| InChI | InChI=1S/C25H23N5O5/c1-33-18-8-9-21(22-10-11-26-35-22)23(14-18)34-16-17-15-29(28-27-17)12-4-5-13-30-24(31)19-6-2-3-7-20(19)25(30)32/h2-3,6-11,14-15H,4-5,12-13,16H2,1H3 |
| InChIKey | SFVLPCDSJQBSRT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|