C18H16N4OS — CID 139221772
4-(2-hydroxyphenyl)-3-methyl-1-phenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione (PubChem CID 139221772) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-3-methyl-1-phenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione.
| Compound Name | 4-(2-hydroxyphenyl)-3-methyl-1-phenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione |
|---|---|
| PubChem CID | 139221772 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-(2-hydroxyphenyl)-3-methyl-1-phenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1O)NC(=S)N2 |
| InChI | InChI=1S/C18H16N4OS/c1-11-15-16(13-9-5-6-10-14(13)23)19-18(24)20-17(15)22(21-11)12-7-3-2-4-8-12/h2-10,16,23H,1H3,(H2,19,20,24) |
| InChIKey | YXDWZBQPCSZDIS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|