C8H4Cl2F5N3OS — CID 139221874
2,2-dichloro-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 139221874) has the molecular formula C8H4Cl2F5N3OS and a molecular weight of 356.10 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139221874 |
| Molecular Formula | C8H4Cl2F5N3OS |
| Molecular Weight | 356.10 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 2,2-dichloro-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nnc(C(F)(F)C(F)(F)F)s1)C1CC1(Cl)Cl |
| InChI | InChI=1S/C8H4Cl2F5N3OS/c9-6(10)1-2(6)3(19)16-5-18-17-4(20-5)7(11,12)8(13,14)15/h2H,1H2,(H,16,18,19) |
| InChIKey | QKSAZTRYSNRFAB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.10 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|