C17H16N8O — CID 139222005
N-amino-N'-[4-cyano-1-[6-(3-methoxyphenyl)-4-methylpyridazin-3-yl]pyrazol-5-yl]methanimidamide (PubChem CID 139222005) has the molecular formula C17H16N8O and a molecular weight of 348.37 g/mol. Its IUPAC name is N-amino-N'-[4-cyano-1-[6-(3-methoxyphenyl)-4-methylpyridazin-3-yl]pyrazol-5-yl]methanimidamide.
| Compound Name | N-amino-N'-[4-cyano-1-[6-(3-methoxyphenyl)-4-methylpyridazin-3-yl]pyrazol-5-yl]methanimidamide |
|---|---|
| PubChem CID | 139222005 |
| Molecular Formula | C17H16N8O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-amino-N'-[4-cyano-1-[6-(3-methoxyphenyl)-4-methylpyridazin-3-yl]pyrazol-5-yl]methanimidamide |
| SMILES | COc1cccc(-c2cc(C)c(-n3ncc(C#N)c3/N=C\NN)nn2)c1 |
| InChI | InChI=1S/C17H16N8O/c1-11-6-15(12-4-3-5-14(7-12)26-2)23-24-16(11)25-17(20-10-21-19)13(8-18)9-22-25/h3-7,9-10H,19H2,1-2H3,(H,20,21) |
| InChIKey | GWWZRIPDUBFTIM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|