About 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile
2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 139222342) has the molecular formula C26H18N4O2
and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| PubChem CID | 139222342 |
| Molecular Formula | C26H18N4O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | Cc1ccc(Oc2nc3c(C#N)cn(-c4ccccc4)c3c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H18N4O2/c1-18-12-14-22(15-13-18)32-26-28-23-19(16-27)17-29(20-8-4-2-5-9-20)24(23)25(31)30(26)21-10-6-3-7-11-21/h2-15,17H,1H3 |
| InChIKey | SMLKSSVIZSFAML-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The IUPAC name of 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile (CID 139222342) is 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile.
What is the SMILES notation for 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The canonical SMILES for 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile is Cc1ccc(Oc2nc3c(C#N)cn(-c4ccccc4)c3c(=O)n2-c2ccccc2)cc1.
What is the InChIKey of 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
The InChIKey is SMLKSSVIZSFAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N4O2/c1-18-12-14-22(15-13-18)32-26-28-23-19(16-27)17-29(20-8-4-2-5-9-20)24(23)25(31)30(26)21-10-6-3-7-11-21/h2-15,17H,1H3.
What are the key properties of 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile?
2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile has a molecular weight of 418.46 g/mol, XLogP of 5.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenoxy)-4-oxo-3,5-diphenylpyrrolo[3,2-d]pyrimidine-7-carbonitrile is sourced from PubChem (CID 139222342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).