C16H14N4O3S — CID 139222679
12-amino-8-(3-methoxyphenyl)-5-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione (PubChem CID 139222679) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 12-amino-8-(3-methoxyphenyl)-5-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione.
| Compound Name | 12-amino-8-(3-methoxyphenyl)-5-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione |
|---|---|
| PubChem CID | 139222679 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 12-amino-8-(3-methoxyphenyl)-5-thia-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),12-triene-6,10-dione |
| SMILES | COc1cccc(C2C3=C(CSC3=O)Nc3nc(N)[nH]c(=O)c32)c1 |
| InChI | InChI=1S/C16H14N4O3S/c1-23-8-4-2-3-7(5-8)10-11-9(6-24-15(11)22)18-13-12(10)14(21)20-16(17)19-13/h2-5,10H,6H2,1H3,(H4,17,18,19,20,21) |
| InChIKey | AXAYXEZWZOALOT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|