C16H15N3O2S — CID 139222785
6-acetyl-7-methyl-5-phenyl-2-sulfanylidene-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 139222785) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 6-acetyl-7-methyl-5-phenyl-2-sulfanylidene-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 6-acetyl-7-methyl-5-phenyl-2-sulfanylidene-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 139222785 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 6-acetyl-7-methyl-5-phenyl-2-sulfanylidene-5,8-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CC(=O)C1=C(C)Nc2[nH]c(=S)[nH]c(=O)c2C1c1ccccc1 |
| InChI | InChI=1S/C16H15N3O2S/c1-8-11(9(2)20)12(10-6-4-3-5-7-10)13-14(17-8)18-16(22)19-15(13)21/h3-7,12H,1-2H3,(H3,17,18,19,21,22) |
| InChIKey | MCUPYIIAYXWZJL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|