About 3-(propylamino)-1,2-dihydropyrrol-5-one
3-(propylamino)-1,2-dihydropyrrol-5-one (PubChem CID 139223926) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-(propylamino)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-(propylamino)-1,2-dihydropyrrol-5-one |
| PubChem CID | 139223926 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-(propylamino)-1,2-dihydropyrrol-5-one |
| SMILES | CCCNC1=CC(=O)NC1 |
| InChI | InChI=1S/C7H12N2O/c1-2-3-8-6-4-7(10)9-5-6/h4,8H,2-3,5H2,1H3,(H,9,10) |
| InChIKey | MNFCXJXSNKJJST-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(propylamino)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propylamino)-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-(propylamino)-1,2-dihydropyrrol-5-one (CID 139223926) is 3-(propylamino)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-(propylamino)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-(propylamino)-1,2-dihydropyrrol-5-one is CCCNC1=CC(=O)NC1.
What is the InChIKey of 3-(propylamino)-1,2-dihydropyrrol-5-one?
The InChIKey is MNFCXJXSNKJJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-2-3-8-6-4-7(10)9-5-6/h4,8H,2-3,5H2,1H3,(H,9,10).
What are the key properties of 3-(propylamino)-1,2-dihydropyrrol-5-one?
3-(propylamino)-1,2-dihydropyrrol-5-one has a molecular weight of 140.19 g/mol, XLogP of -0.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propylamino)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 139223926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).