About 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one
2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one (PubChem CID 139223930) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one |
| PubChem CID | 139223930 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one |
| SMILES | CCCNC1=CC(=O)NC1C |
| InChI | InChI=1S/C8H14N2O/c1-3-4-9-7-5-8(11)10-6(7)2/h5-6,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | QYDLDSBTPUHFHH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
The IUPAC name of 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one (CID 139223930) is 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one is CCCNC1=CC(=O)NC1C.
What is the InChIKey of 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
The InChIKey is QYDLDSBTPUHFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-3-4-9-7-5-8(11)10-6(7)2/h5-6,9H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one has a molecular weight of 154.21 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(propylamino)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 139223930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).