About 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one
2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one (PubChem CID 139223934) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one |
| PubChem CID | 139223934 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one |
| SMILES | CCCNC1=CC(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c1-2-8-14-11-9-12(16)15-13(11)10-6-4-3-5-7-10/h3-7,9,13-14H,2,8H2,1H3,(H,15,16) |
| InChIKey | XICZLJYLYXPECH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
The IUPAC name of 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one (CID 139223934) is 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one is CCCNC1=CC(=O)NC1c1ccccc1.
What is the InChIKey of 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
The InChIKey is XICZLJYLYXPECH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-2-8-14-11-9-12(16)15-13(11)10-6-4-3-5-7-10/h3-7,9,13-14H,2,8H2,1H3,(H,15,16).
What are the key properties of 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one?
2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one has a molecular weight of 216.28 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3-(propylamino)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 139223934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).