C22H16N4 — CID 139224028
N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine (PubChem CID 139224028) has the molecular formula C22H16N4 and a molecular weight of 336.40 g/mol. Its IUPAC name is N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine.
| Compound Name | N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine |
|---|---|
| PubChem CID | 139224028 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine |
| SMILES | c1ccc(/N=c2\cc3[nH]c4ccccc4c3nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16N4/c1-3-9-16(10-4-1)23-21-15-20-22(18-13-7-8-14-19(18)24-20)25-26(21)17-11-5-2-6-12-17/h1-15,24H/b23-21+ |
| InChIKey | MTPOFOGGUJBDBG-XTQSDGFTSA-N |
| XLogP | 4.74 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |