About N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine
N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine (PubChem CID 139224028) has the molecular formula C22H16N4
and a molecular weight of 336.40 g/mol. Its IUPAC name is N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine.
Molecular Properties
| Compound Name | N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine |
| PubChem CID | 139224028 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine |
| SMILES | c1ccc(/N=c2\cc3[nH]c4ccccc4c3nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16N4/c1-3-9-16(10-4-1)23-21-15-20-22(18-13-7-8-14-19(18)24-20)25-26(21)17-11-5-2-6-12-17/h1-15,24H/b23-21+ |
| InChIKey | MTPOFOGGUJBDBG-XTQSDGFTSA-N |
| XLogP | 4.74 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine?
The IUPAC name of N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine (CID 139224028) is N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine.
What is the SMILES notation for N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine?
The canonical SMILES for N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine is c1ccc(/N=c2\cc3[nH]c4ccccc4c3nn2-c2ccccc2)cc1.
What is the InChIKey of N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine?
The InChIKey is MTPOFOGGUJBDBG-XTQSDGFTSA-N. The full InChI is InChI=1S/C22H16N4/c1-3-9-16(10-4-1)23-21-15-20-22(18-13-7-8-14-19(18)24-20)25-26(21)17-11-5-2-6-12-17/h1-15,24H/b23-21+.
What are the key properties of N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine?
N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine has a molecular weight of 336.40 g/mol, XLogP of 4.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diphenyl-5H-pyridazino[4,3-b]indol-3-imine is sourced from PubChem (CID 139224028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).