About [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate
[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate (PubChem CID 139224219) has the molecular formula C20H22N2O6S
and a molecular weight of 418.47 g/mol. Its IUPAC name is [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate.
Molecular Properties
| Compound Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate |
| PubChem CID | 139224219 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2OC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H22N2O6S/c1-14-9-11-17(12-10-14)29(26,27)21-18-7-2-3-8-19(18)28-20(23)15-5-4-6-16(13-15)22(24)25/h4-6,9-13,18-19,21H,2-3,7-8H2,1H3/t18-,19-/m1/s1 |
| InChIKey | PMKNEGJVRWAHIH-RTBURBONSA-N |
| XLogP | 3.35 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate?
The IUPAC name of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate (CID 139224219) is [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate.
What is the SMILES notation for [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate?
The canonical SMILES for [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate is Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2OC(=O)c2cccc([N+](=O)[O-])c2)cc1.
What is the InChIKey of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate?
The InChIKey is PMKNEGJVRWAHIH-RTBURBONSA-N. The full InChI is InChI=1S/C20H22N2O6S/c1-14-9-11-17(12-10-14)29(26,27)21-18-7-2-3-8-19(18)28-20(23)15-5-4-6-16(13-15)22(24)25/h4-6,9-13,18-19,21H,2-3,7-8H2,1H3/t18-,19-/m1/s1.
What are the key properties of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate?
[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate has a molecular weight of 418.47 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 3-nitrobenzoate is sourced from PubChem (CID 139224219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).