About 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide
4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide (PubChem CID 139224368) has the molecular formula C19H13F4N3O
and a molecular weight of 375.33 g/mol. Its IUPAC name is 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
| PubChem CID | 139224368 |
| Molecular Formula | C19H13F4N3O |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide |
| SMILES | O=C(NNc1cc(C(F)(F)F)cc(-c2ccccc2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13F4N3O/c20-15-8-6-13(7-9-15)18(27)26-25-17-11-14(19(21,22)23)10-16(24-17)12-4-2-1-3-5-12/h1-11H,(H,24,25)(H,26,27) |
| InChIKey | JRLCCGANVUIEMC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide?
The IUPAC name of 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide (CID 139224368) is 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide.
What is the SMILES notation for 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide?
The canonical SMILES for 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide is O=C(NNc1cc(C(F)(F)F)cc(-c2ccccc2)n1)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide?
The InChIKey is JRLCCGANVUIEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F4N3O/c20-15-8-6-13(7-9-15)18(27)26-25-17-11-14(19(21,22)23)10-16(24-17)12-4-2-1-3-5-12/h1-11H,(H,24,25)(H,26,27).
What are the key properties of 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide?
4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide has a molecular weight of 375.33 g/mol, XLogP of 4.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N'-[6-phenyl-4-(trifluoromethyl)-2-pyridinyl]benzohydrazide is sourced from PubChem (CID 139224368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).