C13H10N4O2S2 — CID 139224805
3-[(E)-C-methyl-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]carbonimidoyl]chromen-2-one (PubChem CID 139224805) has the molecular formula C13H10N4O2S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[(E)-C-methyl-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]carbonimidoyl]chromen-2-one.
| Compound Name | 3-[(E)-C-methyl-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]carbonimidoyl]chromen-2-one |
|---|---|
| PubChem CID | 139224805 |
| Molecular Formula | C13H10N4O2S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-[(E)-C-methyl-N-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]carbonimidoyl]chromen-2-one |
| SMILES | C/C(=N\Nc1n[nH]c(=S)s1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H10N4O2S2/c1-7(14-15-12-16-17-13(20)21-12)9-6-8-4-2-3-5-10(8)19-11(9)18/h2-6H,1H3,(H,15,16)(H,17,20)/b14-7+ |
| InChIKey | KTQVOJYBROSIGD-VGOFMYFVSA-N |
| XLogP | 3.14 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|