About N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide
N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide (PubChem CID 139224983) has the molecular formula C17H13N5O2
and a molecular weight of 319.32 g/mol. Its IUPAC name is N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide.
Molecular Properties
| Compound Name | N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide |
| PubChem CID | 139224983 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide |
| SMILES | N#Cc1c(N/C=N/Cc2ccccc2)[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C17H13N5O2/c18-10-16-17(20-12-19-11-13-6-2-1-3-7-13)22(24)15-9-5-4-8-14(15)21(16)23/h1-9,12H,11H2,(H,19,20) |
| InChIKey | ZHDAHLHXCVFPMF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide?
The IUPAC name of N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide (CID 139224983) is N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide.
What is the SMILES notation for N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide?
The canonical SMILES for N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide is N#Cc1c(N/C=N/Cc2ccccc2)[n+]([O-])c2ccccc2[n+]1[O-].
What is the InChIKey of N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide?
The InChIKey is ZHDAHLHXCVFPMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5O2/c18-10-16-17(20-12-19-11-13-6-2-1-3-7-13)22(24)15-9-5-4-8-14(15)21(16)23/h1-9,12H,11H2,(H,19,20).
What are the key properties of N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide?
N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide has a molecular weight of 319.32 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-(3-cyano-1,4-dioxidoquinoxaline-1,4-diium-2-yl)methanimidamide is sourced from PubChem (CID 139224983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).