About ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate
ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate (PubChem CID 139225274) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate |
| PubChem CID | 139225274 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cccc(C)c2)o1 |
| InChI | InChI=1S/C13H14N2O3/c1-3-17-12(16)11-8-14-13(18-11)15-10-6-4-5-9(2)7-10/h4-8H,3H2,1-2H3,(H,14,15) |
| InChIKey | TUZFXKYLHPYUED-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate (CID 139225274) is ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate is CCOC(=O)c1cnc(Nc2cccc(C)c2)o1.
What is the InChIKey of ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate?
The InChIKey is TUZFXKYLHPYUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-3-17-12(16)11-8-14-13(18-11)15-10-6-4-5-9(2)7-10/h4-8H,3H2,1-2H3,(H,14,15).
What are the key properties of ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate?
ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate has a molecular weight of 246.27 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-methylanilino)-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 139225274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).