C25H24N2O3 — CID 139225452
1-(4-methoxyphenyl)-3-methyl-7-(4-methylpent-3-enyl)benzo[f]indazole-4,9-dione (PubChem CID 139225452) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-methyl-7-(4-methylpent-3-enyl)benzo[f]indazole-4,9-dione.
| Compound Name | 1-(4-methoxyphenyl)-3-methyl-7-(4-methylpent-3-enyl)benzo[f]indazole-4,9-dione |
|---|---|
| PubChem CID | 139225452 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-methyl-7-(4-methylpent-3-enyl)benzo[f]indazole-4,9-dione |
| SMILES | COc1ccc(-n2nc(C)c3c2C(=O)c2cc(CCC=C(C)C)ccc2C3=O)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-15(2)6-5-7-17-8-13-20-21(14-17)25(29)23-22(24(20)28)16(3)26-27(23)18-9-11-19(30-4)12-10-18/h6,8-14H,5,7H2,1-4H3 |
| InChIKey | AADKCBKOMFCELR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|