About 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide
8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide (PubChem CID 139225553) has the molecular formula C10H13IN2O
and a molecular weight of 304.13 g/mol. Its IUPAC name is 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide.
Molecular Properties
| Compound Name | 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide |
| PubChem CID | 139225553 |
| Molecular Formula | C10H13IN2O |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide |
| SMILES | COc1c(C)ccn2cc[n+](C)c12.[I-] |
| InChI | InChI=1S/C10H13N2O.HI/c1-8-4-5-12-7-6-11(2)10(12)9(8)13-3;/h4-7H,1-3H3;1H/q+1;/p-1 |
| InChIKey | IEZYDZNDKWLWOV-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 17.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide?
The IUPAC name of 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide (CID 139225553) is 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide.
What is the SMILES notation for 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide?
The canonical SMILES for 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide is COc1c(C)ccn2cc[n+](C)c12.[I-].
What is the InChIKey of 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide?
The InChIKey is IEZYDZNDKWLWOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13N2O.HI/c1-8-4-5-12-7-6-11(2)10(12)9(8)13-3;/h4-7H,1-3H3;1H/q+1;/p-1.
What are the key properties of 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide?
8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide has a molecular weight of 304.13 g/mol, XLogP of -1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1,7-dimethylimidazo[1,2-a]pyridin-1-ium iodide is sourced from PubChem (CID 139225553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).