C24H21Br2NO3 — CID 139225646
[1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl] acetate (PubChem CID 139225646) has the molecular formula C24H21Br2NO3 and a molecular weight of 531.24 g/mol. Its IUPAC name is [1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl] acetate.
| Compound Name | [1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl] acetate |
|---|---|
| PubChem CID | 139225646 |
| Molecular Formula | C24H21Br2NO3 |
| Molecular Weight | 531.24 g/mol |
| Exact Mass | 528.99 |
| IUPAC Name | [1,2-bis(4-bromophenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-7-yl] acetate |
| SMILES | CC(=O)OC1c2c(cc(-c3ccc(Br)cc3)n2-c2ccc(Br)cc2)C(=O)CC1(C)C |
| InChI | InChI=1S/C24H21Br2NO3/c1-14(28)30-23-22-19(21(29)13-24(23,2)3)12-20(15-4-6-16(25)7-5-15)27(22)18-10-8-17(26)9-11-18/h4-12,23H,13H2,1-3H3 |
| InChIKey | XJNDBJKHAHFLIU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.24 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|