C19H17N5OS — CID 139225782
4-methoxy-N,N-dimethyl-N'-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)benzenecarboximidamide (PubChem CID 139225782) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-N'-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)benzenecarboximidamide.
| Compound Name | 4-methoxy-N,N-dimethyl-N'-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 139225782 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-N'-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)benzenecarboximidamide |
| SMILES | COc1ccc(/C(=N/c2ncnc3c2sc2ncccc23)N(C)C)cc1 |
| InChI | InChI=1S/C19H17N5OS/c1-24(2)18(12-6-8-13(25-3)9-7-12)23-17-16-15(21-11-22-17)14-5-4-10-20-19(14)26-16/h4-11H,1-3H3/b23-18- |
| InChIKey | WWRPMOUHUANECU-NKFKGCMQSA-N |
| XLogP | 3.89 |
| TPSA | 63.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|