C12H14BrN5O2 — CID 139226150
2-[[3-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyridazin-5-yl]amino]acetohydrazide (PubChem CID 139226150) has the molecular formula C12H14BrN5O2 and a molecular weight of 340.18 g/mol. Its IUPAC name is 2-[[3-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyridazin-5-yl]amino]acetohydrazide.
| Compound Name | 2-[[3-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyridazin-5-yl]amino]acetohydrazide |
|---|---|
| PubChem CID | 139226150 |
| Molecular Formula | C12H14BrN5O2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-[[3-(4-bromophenyl)-6-oxo-4,5-dihydro-1H-pyridazin-5-yl]amino]acetohydrazide |
| SMILES | NNC(=O)CNC1CC(c2ccc(Br)cc2)=NNC1=O |
| InChI | InChI=1S/C12H14BrN5O2/c13-8-3-1-7(2-4-8)9-5-10(12(20)18-17-9)15-6-11(19)16-14/h1-4,10,15H,5-6,14H2,(H,16,19)(H,18,20) |
| InChIKey | HSDWEOPJWHFJJK-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|