C18H14ClF3N4O2 — CID 139226300
propan-2-yl 5-(6-chloro-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylate (PubChem CID 139226300) has the molecular formula C18H14ClF3N4O2 and a molecular weight of 410.78 g/mol. Its IUPAC name is propan-2-yl 5-(6-chloro-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylate.
| Compound Name | propan-2-yl 5-(6-chloro-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 139226300 |
| Molecular Formula | C18H14ClF3N4O2 |
| Molecular Weight | 410.78 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | propan-2-yl 5-(6-chloro-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylate |
| SMILES | CC(C)OC(=O)c1nnn(-c2cccc(C(F)(F)F)c2)c1-c1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H14ClF3N4O2/c1-10(2)28-17(27)15-16(11-6-7-14(19)23-9-11)26(25-24-15)13-5-3-4-12(8-13)18(20,21)22/h3-10H,1-2H3 |
| InChIKey | HEKXRCIIBNZOOK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|