C21H19ClN4 — CID 139226380
5-chloro-17-(4-methylphenyl)-8,13,16,18-tetrazatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2(7),3,5,12,17-hexaene (PubChem CID 139226380) has the molecular formula C21H19ClN4 and a molecular weight of 362.86 g/mol. Its IUPAC name is 5-chloro-17-(4-methylphenyl)-8,13,16,18-tetrazatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2(7),3,5,12,17-hexaene.
| Compound Name | 5-chloro-17-(4-methylphenyl)-8,13,16,18-tetrazatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2(7),3,5,12,17-hexaene |
|---|---|
| PubChem CID | 139226380 |
| Molecular Formula | C21H19ClN4 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-chloro-17-(4-methylphenyl)-8,13,16,18-tetrazatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2(7),3,5,12,17-hexaene |
| SMILES | Cc1ccc(C2=NC3=C(CCNc4cc(Cl)ccc43)C3=NCCN32)cc1 |
| InChI | InChI=1S/C21H19ClN4/c1-13-2-4-14(5-3-13)20-25-19-16-7-6-15(22)12-18(16)23-9-8-17(19)21-24-10-11-26(20)21/h2-7,12,23H,8-11H2,1H3 |
| InChIKey | KRZIGOTYYWCDMS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |