About 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride
2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride (PubChem CID 139226401) has the molecular formula C8H17BrClNO
and a molecular weight of 258.59 g/mol. Its IUPAC name is 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride |
| PubChem CID | 139226401 |
| Molecular Formula | C8H17BrClNO |
| Molecular Weight | 258.59 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride |
| SMILES | CC(C)N(C(=O)CBr)C(C)C.Cl |
| InChI | InChI=1S/C8H16BrNO.ClH/c1-6(2)10(7(3)4)8(11)5-9;/h6-7H,5H2,1-4H3;1H |
| InChIKey | BXXYQXWPSANWBS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride?
The IUPAC name of 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride (CID 139226401) is 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride?
The canonical SMILES for 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride is CC(C)N(C(=O)CBr)C(C)C.Cl.
What is the InChIKey of 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride?
The InChIKey is BXXYQXWPSANWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BrNO.ClH/c1-6(2)10(7(3)4)8(11)5-9;/h6-7H,5H2,1-4H3;1H.
What are the key properties of 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride?
2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride has a molecular weight of 258.59 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-di(propan-2-yl)acetamide;hydrochloride is sourced from PubChem (CID 139226401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).