About methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride
methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride (PubChem CID 139226549) has the molecular formula C15H26ClN3O2S
and a molecular weight of 347.91 g/mol. Its IUPAC name is methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride |
| PubChem CID | 139226549 |
| Molecular Formula | C15H26ClN3O2S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)CCc1ncc(N2CCC(N)CC2)s1.Cl |
| InChI | InChI=1S/C15H25N3O2S.ClH/c1-15(2,14(19)20-3)7-4-12-17-10-13(21-12)18-8-5-11(16)6-9-18;/h10-11H,4-9,16H2,1-3H3;1H |
| InChIKey | WIAMFBDTTDDBMS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride?
The IUPAC name of methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride (CID 139226549) is methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride.
What is the SMILES notation for methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride?
The canonical SMILES for methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride is COC(=O)C(C)(C)CCc1ncc(N2CCC(N)CC2)s1.Cl.
What is the InChIKey of methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride?
The InChIKey is WIAMFBDTTDDBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2S.ClH/c1-15(2,14(19)20-3)7-4-12-17-10-13(21-12)18-8-5-11(16)6-9-18;/h10-11H,4-9,16H2,1-3H3;1H.
What are the key properties of methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride?
methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride has a molecular weight of 347.91 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[5-(4-aminopiperidin-1-yl)-1,3-thiazol-2-yl]-2,2-dimethylbutanoate;hydrochloride is sourced from PubChem (CID 139226549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).