C20H11N3O3S — CID 139226722
2-anilino-4,6,11-trioxo-5H-benzo[h][1,5]benzothiazepine-3-carbonitrile (PubChem CID 139226722) has the molecular formula C20H11N3O3S and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-anilino-4,6,11-trioxo-5H-benzo[h][1,5]benzothiazepine-3-carbonitrile.
| Compound Name | 2-anilino-4,6,11-trioxo-5H-benzo[h][1,5]benzothiazepine-3-carbonitrile |
|---|---|
| PubChem CID | 139226722 |
| Molecular Formula | C20H11N3O3S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-anilino-4,6,11-trioxo-5H-benzo[h][1,5]benzothiazepine-3-carbonitrile |
| SMILES | N#Cc1c(Nc2ccccc2)sc2c(=O)c3ccccc3c(=O)c=2[nH]c1=O |
| InChI | InChI=1S/C20H11N3O3S/c21-10-14-19(26)23-15-16(24)12-8-4-5-9-13(12)17(25)18(15)27-20(14)22-11-6-2-1-3-7-11/h1-9,22H,(H,23,26) |
| InChIKey | CNBUVNVFTBVEHE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|