C22H15N3O3S — CID 139226962
3-hydroxy-2,8-bis(4-methylphenyl)-4,6-dioxopyrimido[2,1-b][1,3]thiazine-7-carbonitrile (PubChem CID 139226962) has the molecular formula C22H15N3O3S and a molecular weight of 401.45 g/mol. Its IUPAC name is 3-hydroxy-2,8-bis(4-methylphenyl)-4,6-dioxopyrimido[2,1-b][1,3]thiazine-7-carbonitrile.
| Compound Name | 3-hydroxy-2,8-bis(4-methylphenyl)-4,6-dioxopyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
|---|---|
| PubChem CID | 139226962 |
| Molecular Formula | C22H15N3O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 3-hydroxy-2,8-bis(4-methylphenyl)-4,6-dioxopyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
| SMILES | Cc1ccc(-c2nc3sc(-c4ccc(C)cc4)c(O)c(=O)n3c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C22H15N3O3S/c1-12-3-7-14(8-4-12)17-16(11-23)20(27)25-21(28)18(26)19(29-22(25)24-17)15-9-5-13(2)6-10-15/h3-10,26H,1-2H3 |
| InChIKey | KIPMKKSIVIEINO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|