About 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one
8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 139228084) has the molecular formula C12H9N3O
and a molecular weight of 211.22 g/mol. Its IUPAC name is 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one.
Molecular Properties
| Compound Name | 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one |
| PubChem CID | 139228084 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | O=c1[nH]cc(-c2ccccc2)c2nccn12 |
| InChI | InChI=1S/C12H9N3O/c16-12-14-8-10(9-4-2-1-3-5-9)11-13-6-7-15(11)12/h1-8H,(H,14,16) |
| InChIKey | KJPXWWWLQBBKAZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one?
The IUPAC name of 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one (CID 139228084) is 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one.
What is the SMILES notation for 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one?
The canonical SMILES for 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one is O=c1[nH]cc(-c2ccccc2)c2nccn12.
What is the InChIKey of 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one?
The InChIKey is KJPXWWWLQBBKAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O/c16-12-14-8-10(9-4-2-1-3-5-9)11-13-6-7-15(11)12/h1-8H,(H,14,16).
What are the key properties of 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one?
8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one has a molecular weight of 211.22 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenyl-6H-imidazo[1,2-c]pyrimidin-5-one is sourced from PubChem (CID 139228084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).