C26H20N2O — CID 139228317
5-[1-(1-benzofuran-2-yl)-1-(1H-indol-5-yl)ethyl]-1H-indole (PubChem CID 139228317) has the molecular formula C26H20N2O and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-[1-(1-benzofuran-2-yl)-1-(1H-indol-5-yl)ethyl]-1H-indole.
| Compound Name | 5-[1-(1-benzofuran-2-yl)-1-(1H-indol-5-yl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 139228317 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-[1-(1-benzofuran-2-yl)-1-(1H-indol-5-yl)ethyl]-1H-indole |
| SMILES | CC(c1ccc2[nH]ccc2c1)(c1ccc2[nH]ccc2c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C26H20N2O/c1-26(20-6-8-22-17(14-20)10-12-27-22,21-7-9-23-18(15-21)11-13-28-23)25-16-19-4-2-3-5-24(19)29-25/h2-16,27-28H,1H3 |
| InChIKey | DSOOIAQTJSMNDN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 44.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |