About N'-aminopyrimidine-2-carboximidamide;hydrochloride
N'-aminopyrimidine-2-carboximidamide;hydrochloride (PubChem CID 139228373) has the molecular formula C5H8ClN5
and a molecular weight of 173.61 g/mol. Its IUPAC name is N'-aminopyrimidine-2-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-aminopyrimidine-2-carboximidamide;hydrochloride |
| PubChem CID | 139228373 |
| Molecular Formula | C5H8ClN5 |
| Molecular Weight | 173.61 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | N'-aminopyrimidine-2-carboximidamide;hydrochloride |
| SMILES | Cl.N/N=C(/N)c1ncccn1 |
| InChI | InChI=1S/C5H7N5.ClH/c6-4(10-7)5-8-2-1-3-9-5;/h1-3H,7H2,(H2,6,10);1H |
| InChIKey | CKAVIMBRTFWIJN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.61 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminopyrimidine-2-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminopyrimidine-2-carboximidamide;hydrochloride?
The IUPAC name of N'-aminopyrimidine-2-carboximidamide;hydrochloride (CID 139228373) is N'-aminopyrimidine-2-carboximidamide;hydrochloride.
What is the SMILES notation for N'-aminopyrimidine-2-carboximidamide;hydrochloride?
The canonical SMILES for N'-aminopyrimidine-2-carboximidamide;hydrochloride is Cl.N/N=C(/N)c1ncccn1.
What is the InChIKey of N'-aminopyrimidine-2-carboximidamide;hydrochloride?
The InChIKey is CKAVIMBRTFWIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5.ClH/c6-4(10-7)5-8-2-1-3-9-5;/h1-3H,7H2,(H2,6,10);1H.
What are the key properties of N'-aminopyrimidine-2-carboximidamide;hydrochloride?
N'-aminopyrimidine-2-carboximidamide;hydrochloride has a molecular weight of 173.61 g/mol, XLogP of -0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminopyrimidine-2-carboximidamide;hydrochloride is sourced from PubChem (CID 139228373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).