C25H18ClN5O2 — CID 139228429
(E,2E)-4-(4-chlorophenyl)-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]but-3-enoic acid (PubChem CID 139228429) has the molecular formula C25H18ClN5O2 and a molecular weight of 455.91 g/mol. Its IUPAC name is (E,2E)-4-(4-chlorophenyl)-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]but-3-enoic acid.
| Compound Name | (E,2E)-4-(4-chlorophenyl)-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]but-3-enoic acid |
|---|---|
| PubChem CID | 139228429 |
| Molecular Formula | C25H18ClN5O2 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (E,2E)-4-(4-chlorophenyl)-2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]but-3-enoic acid |
| SMILES | O=C(O)C(/C=C/c1ccc(Cl)cc1)=N/Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H18ClN5O2/c26-20-14-11-17(12-15-20)13-16-21(24(32)33)28-30-25-27-22(18-7-3-1-4-8-18)23(29-31-25)19-9-5-2-6-10-19/h1-16H,(H,32,33)(H,27,30,31)/b16-13+,28-21+ |
| InChIKey | DWRZPBVGPMPCOR-DFQNUQAKSA-N |
| XLogP | 5.42 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|