C17H18N2O2S — CID 139228536
11-amino-2,2-dimethyl-3,7,8,9-tetrahydro-1H-[1]benzothiolo[2,3-b]quinoline-4,10-dione (PubChem CID 139228536) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 11-amino-2,2-dimethyl-3,7,8,9-tetrahydro-1H-[1]benzothiolo[2,3-b]quinoline-4,10-dione.
| Compound Name | 11-amino-2,2-dimethyl-3,7,8,9-tetrahydro-1H-[1]benzothiolo[2,3-b]quinoline-4,10-dione |
|---|---|
| PubChem CID | 139228536 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 11-amino-2,2-dimethyl-3,7,8,9-tetrahydro-1H-[1]benzothiolo[2,3-b]quinoline-4,10-dione |
| SMILES | CC1(C)CC(=O)c2sc3nc4c(c(N)c3c2C1)C(=O)CCC4 |
| InChI | InChI=1S/C17H18N2O2S/c1-17(2)6-8-12-14(18)13-9(4-3-5-10(13)20)19-16(12)22-15(8)11(21)7-17/h3-7H2,1-2H3,(H2,18,19) |
| InChIKey | PXXCPWXEDUNFHM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |