C19H31NO — CID 139228555
3-butyl-5-methyl-2-pentyl-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 139228555) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 3-butyl-5-methyl-2-pentyl-3,4-dihydro-2H-1,5-benzoxazepine.
| Compound Name | 3-butyl-5-methyl-2-pentyl-3,4-dihydro-2H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 139228555 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 3-butyl-5-methyl-2-pentyl-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | CCCCCC1Oc2ccccc2N(C)CC1CCCC |
| InChI | InChI=1S/C19H31NO/c1-4-6-8-13-18-16(11-7-5-2)15-20(3)17-12-9-10-14-19(17)21-18/h9-10,12,14,16,18H,4-8,11,13,15H2,1-3H3 |
| InChIKey | SZEFUDGIMAZJMS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|