C34H26N6O2S — CID 139228627
1-(4-methoxyphenyl)-3a-phenyl-5-[2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine (PubChem CID 139228627) has the molecular formula C34H26N6O2S and a molecular weight of 582.69 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3a-phenyl-5-[2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine.
| Compound Name | 1-(4-methoxyphenyl)-3a-phenyl-5-[2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine |
|---|---|
| PubChem CID | 139228627 |
| Molecular Formula | C34H26N6O2S |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-3a-phenyl-5-[2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine |
| SMILES | COc1ccc(C2=NOC3(c4ccccc4)CC(c4cc5ccccc5nc4-n4cncn4)Sc4ccccc4N23)cc1 |
| InChI | InChI=1S/C34H26N6O2S/c1-41-26-17-15-23(16-18-26)32-38-42-34(25-10-3-2-4-11-25)20-31(43-30-14-8-7-13-29(30)40(32)34)27-19-24-9-5-6-12-28(24)37-33(27)39-22-35-21-36-39/h2-19,21-22,31H,20H2,1H3 |
| InChIKey | UBELOBBFCDGUQC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |