C35H27ClN6OS — CID 139228638
3a-(4-chlorophenyl)-1-(4-methylphenyl)-5-[6-methyl-2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine (PubChem CID 139228638) has the molecular formula C35H27ClN6OS and a molecular weight of 615.16 g/mol. Its IUPAC name is 3a-(4-chlorophenyl)-1-(4-methylphenyl)-5-[6-methyl-2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine.
| Compound Name | 3a-(4-chlorophenyl)-1-(4-methylphenyl)-5-[6-methyl-2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine |
|---|---|
| PubChem CID | 139228638 |
| Molecular Formula | C35H27ClN6OS |
| Molecular Weight | 615.16 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | 3a-(4-chlorophenyl)-1-(4-methylphenyl)-5-[6-methyl-2-(1,2,4-triazol-1-yl)quinolin-3-yl]-4,5-dihydro-[1,2,4]oxadiazolo[5,4-d][1,5]benzothiazepine |
| SMILES | Cc1ccc(C2=NOC3(c4ccc(Cl)cc4)CC(c4cc5cc(C)ccc5nc4-n4cncn4)Sc4ccccc4N23)cc1 |
| InChI | InChI=1S/C35H27ClN6OS/c1-22-7-10-24(11-8-22)33-40-43-35(26-12-14-27(36)15-13-26)19-32(44-31-6-4-3-5-30(31)42(33)35)28-18-25-17-23(2)9-16-29(25)39-34(28)41-21-37-20-38-41/h3-18,20-21,32H,19H2,1-2H3 |
| InChIKey | WKPUZSQKPFWNRH-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.16 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |