C24H22N2O2 — CID 139229196
ethyl (3R,4S)-2,3,4-triphenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 139229196) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl (3R,4S)-2,3,4-triphenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl (3R,4S)-2,3,4-triphenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 139229196 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | ethyl (3R,4S)-2,3,4-triphenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2/c1-2-28-24(27)22-21(18-12-6-3-7-13-18)23(19-14-8-4-9-15-19)26(25-22)20-16-10-5-11-17-20/h3-17,21,23H,2H2,1H3/t21-,23+/m1/s1 |
| InChIKey | HKENKWGZEQLAGI-GGAORHGYSA-N |
| XLogP | 4.95 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |