C33H35N3O7 — CID 139229210
12-[(5-tert-butyl-2-hydroxyphenyl)methyl]-6,18-dioxa-9,12,15-triazatetracyclo[21.3.1.05,26.019,24]heptacosa-1(26),2,4,19,21,23-hexaene-8,16,25,27-tetrone (PubChem CID 139229210) has the molecular formula C33H35N3O7 and a molecular weight of 585.66 g/mol. Its IUPAC name is 12-[(5-tert-butyl-2-hydroxyphenyl)methyl]-6,18-dioxa-9,12,15-triazatetracyclo[21.3.1.05,26.019,24]heptacosa-1(26),2,4,19,21,23-hexaene-8,16,25,27-tetrone.
| Compound Name | 12-[(5-tert-butyl-2-hydroxyphenyl)methyl]-6,18-dioxa-9,12,15-triazatetracyclo[21.3.1.05,26.019,24]heptacosa-1(26),2,4,19,21,23-hexaene-8,16,25,27-tetrone |
|---|---|
| PubChem CID | 139229210 |
| Molecular Formula | C33H35N3O7 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 12-[(5-tert-butyl-2-hydroxyphenyl)methyl]-6,18-dioxa-9,12,15-triazatetracyclo[21.3.1.05,26.019,24]heptacosa-1(26),2,4,19,21,23-hexaene-8,16,25,27-tetrone |
| SMILES | CC(C)(C)c1ccc(O)c(CN2CCNC(=O)COc3cccc4c3C(=O)c3c(cccc3C4=O)OCC(=O)NCC2)c1 |
| InChI | InChI=1S/C33H35N3O7/c1-33(2,3)21-10-11-24(37)20(16-21)17-36-14-12-34-27(38)18-42-25-8-4-6-22-29(25)32(41)30-23(31(22)40)7-5-9-26(30)43-19-28(39)35-13-15-36/h4-11,16,37H,12-15,17-19H2,1-3H3,(H,34,38)(H,35,39) |
| InChIKey | VOOBEFHUIAJOMN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|