C19H21N3O2S — CID 139229371
[[(6-methoxy-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-phenylmethyl]amino]thiourea (PubChem CID 139229371) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is [[(6-methoxy-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-phenylmethyl]amino]thiourea.
| Compound Name | [[(6-methoxy-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-phenylmethyl]amino]thiourea |
|---|---|
| PubChem CID | 139229371 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [[(6-methoxy-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)-phenylmethyl]amino]thiourea |
| SMILES | COc1ccc2c(c1)CCC(C(NNC(N)=S)c1ccccc1)C2=O |
| InChI | InChI=1S/C19H21N3O2S/c1-24-14-8-10-15-13(11-14)7-9-16(18(15)23)17(21-22-19(20)25)12-5-3-2-4-6-12/h2-6,8,10-11,16-17,21H,7,9H2,1H3,(H3,20,22,25) |
| InChIKey | SCSPVVKCBYRDDE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|