C20H21N3O2S — CID 139229410
7-methoxy-3-(4-methoxyphenyl)-2,3,4,5-tetrahydrobenzo[g]indazole-1-carbothioamide (PubChem CID 139229410) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 7-methoxy-3-(4-methoxyphenyl)-2,3,4,5-tetrahydrobenzo[g]indazole-1-carbothioamide.
| Compound Name | 7-methoxy-3-(4-methoxyphenyl)-2,3,4,5-tetrahydrobenzo[g]indazole-1-carbothioamide |
|---|---|
| PubChem CID | 139229410 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 7-methoxy-3-(4-methoxyphenyl)-2,3,4,5-tetrahydrobenzo[g]indazole-1-carbothioamide |
| SMILES | COc1ccc(C2NN(C(N)=S)C3=C2CCc2cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-24-14-6-3-12(4-7-14)18-17-9-5-13-11-15(25-2)8-10-16(13)19(17)23(22-18)20(21)26/h3-4,6-8,10-11,18,22H,5,9H2,1-2H3,(H2,21,26) |
| InChIKey | YMSQOLJTFCNSBN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|