C46H34N8O4 — CID 139229467
2,9-bis[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline (PubChem CID 139229467) has the molecular formula C46H34N8O4 and a molecular weight of 762.83 g/mol. Its IUPAC name is 2,9-bis[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 139229467 |
| Molecular Formula | C46H34N8O4 |
| Molecular Weight | 762.83 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | 2,9-bis[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-1,10-phenanthroline |
| SMILES | COc1cccc(-c2nnc(-c3ccc4ccc5ccc(-c6nnc(-c7cccc(OC)c7)c(-c7cccc(OC)c7)n6)nc5c4n3)nc2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C46H34N8O4/c1-55-33-13-5-9-29(23-33)41-43(31-11-7-15-35(25-31)57-3)51-53-45(49-41)37-21-19-27-17-18-28-20-22-38(48-40(28)39(27)47-37)46-50-42(30-10-6-14-34(24-30)56-2)44(52-54-46)32-12-8-16-36(26-32)58-4/h5-26H,1-4H3 |
| InChIKey | VAVVWNFZYKAMNL-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 140.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.83 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|